C24H16FN3O4 — CID 4113472
3-(6-benzoyl-3-oxo-4H-quinoxalin-2-yl)-N-(4-fluorophenyl)-2-oxopropanamide (PubChem CID 4113472) has the molecular formula C24H16FN3O4 and a molecular weight of 429.41 g/mol. Its IUPAC name is 3-(6-benzoyl-3-oxo-4H-quinoxalin-2-yl)-N-(4-fluorophenyl)-2-oxopropanamide.
| Compound Name | 3-(6-benzoyl-3-oxo-4H-quinoxalin-2-yl)-N-(4-fluorophenyl)-2-oxopropanamide |
|---|---|
| PubChem CID | 4113472 |
| Molecular Formula | C24H16FN3O4 |
| Molecular Weight | 429.41 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | 3-(6-benzoyl-3-oxo-4H-quinoxalin-2-yl)-N-(4-fluorophenyl)-2-oxopropanamide |
| SMILES | O=C(Cc1nc2ccc(C(=O)c3ccccc3)cc2[nH]c1=O)C(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C24H16FN3O4/c25-16-7-9-17(10-8-16)26-24(32)21(29)13-20-23(31)28-19-12-15(6-11-18(19)27-20)22(30)14-4-2-1-3-5-14/h1-12H,13H2,(H,26,32)(H,28,31) |
| InChIKey | SVZGQQHNFDMKPJ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 108.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.41 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|