C29H24N6O7 — CID 5467286
methyl (2Z)-3-(6-benzoyl-3-oxo-4H-quinoxalin-2-yl)-2-(carbamoylhydrazinylidene)-5-(4-methylanilino)-4,5-dioxopentanoate (PubChem CID 5467286) has the molecular formula C29H24N6O7 and a molecular weight of 568.55 g/mol. Its IUPAC name is methyl (2Z)-3-(6-benzoyl-3-oxo-4H-quinoxalin-2-yl)-2-(carbamoylhydrazinylidene)-5-(4-methylanilino)-4,5-dioxopentanoate.
| Compound Name | methyl (2Z)-3-(6-benzoyl-3-oxo-4H-quinoxalin-2-yl)-2-(carbamoylhydrazinylidene)-5-(4-methylanilino)-4,5-dioxopentanoate |
|---|---|
| PubChem CID | 5467286 |
| Molecular Formula | C29H24N6O7 |
| Molecular Weight | 568.55 g/mol |
| Exact Mass | 568.17 |
| IUPAC Name | methyl (2Z)-3-(6-benzoyl-3-oxo-4H-quinoxalin-2-yl)-2-(carbamoylhydrazinylidene)-5-(4-methylanilino)-4,5-dioxopentanoate |
| SMILES | COC(=O)/C(=N\NC(N)=O)C(C(=O)C(=O)Nc1ccc(C)cc1)c1nc2ccc(C(=O)c3ccccc3)cc2[nH]c1=O |
| InChI | InChI=1S/C29H24N6O7/c1-15-8-11-18(12-9-15)31-27(39)25(37)21(23(28(40)42-2)34-35-29(30)41)22-26(38)33-20-14-17(10-13-19(20)32-22)24(36)16-6-4-3-5-7-16/h3-14,21H,1-2H3,(H,31,39)(H,33,38)(H3,30,35,41)/b34-23- |
| InChIKey | VPAHOSCJAXNCHK-XSVYLIDLSA-N |
| XLogP | 1.95 |
| TPSA | 202.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.55 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|