C29H24N4OS — CID 27046956
[(S)-(3-oxo-4H-quinoxalin-2-yl)-phenylmethyl] N'-(4-methylphenyl)-N-phenylcarbamimidothioate (PubChem CID 27046956) has the molecular formula C29H24N4OS and a molecular weight of 476.61 g/mol. Its IUPAC name is [(S)-(3-oxo-4H-quinoxalin-2-yl)-phenylmethyl] N'-(4-methylphenyl)-N-phenylcarbamimidothioate.
| Compound Name | [(S)-(3-oxo-4H-quinoxalin-2-yl)-phenylmethyl] N'-(4-methylphenyl)-N-phenylcarbamimidothioate |
|---|---|
| PubChem CID | 27046956 |
| Molecular Formula | C29H24N4OS |
| Molecular Weight | 476.61 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | [(S)-(3-oxo-4H-quinoxalin-2-yl)-phenylmethyl] N'-(4-methylphenyl)-N-phenylcarbamimidothioate |
| SMILES | Cc1ccc(/N=C(\Nc2ccccc2)S[C@@H](c2ccccc2)c2nc3ccccc3[nH]c2=O)cc1 |
| InChI | InChI=1S/C29H24N4OS/c1-20-16-18-23(19-17-20)31-29(30-22-12-6-3-7-13-22)35-27(21-10-4-2-5-11-21)26-28(34)33-25-15-9-8-14-24(25)32-26/h2-19,27H,1H3,(H,30,31)(H,33,34)/t27-/m0/s1 |
| InChIKey | SVLMMWJFOUPJJD-MHZLTWQESA-N |
| XLogP | 6.85 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.61 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|