C27H29N3O2S — CID 5067376
[3-(diethylamino)-2,3-dioxo-1-phenylpropyl] N'-(4-methylphenyl)-N-phenylcarbamimidothioate (PubChem CID 5067376) has the molecular formula C27H29N3O2S and a molecular weight of 459.62 g/mol. Its IUPAC name is [3-(diethylamino)-2,3-dioxo-1-phenylpropyl] N'-(4-methylphenyl)-N-phenylcarbamimidothioate.
| Compound Name | [3-(diethylamino)-2,3-dioxo-1-phenylpropyl] N'-(4-methylphenyl)-N-phenylcarbamimidothioate |
|---|---|
| PubChem CID | 5067376 |
| Molecular Formula | C27H29N3O2S |
| Molecular Weight | 459.62 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | [3-(diethylamino)-2,3-dioxo-1-phenylpropyl] N'-(4-methylphenyl)-N-phenylcarbamimidothioate |
| SMILES | CCN(CC)C(=O)C(=O)C(S/C(=N/c1ccc(C)cc1)Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H29N3O2S/c1-4-30(5-2)26(32)24(31)25(21-12-8-6-9-13-21)33-27(28-22-14-10-7-11-15-22)29-23-18-16-20(3)17-19-23/h6-19,25H,4-5H2,1-3H3,(H,28,29) |
| InChIKey | KXEJTEHHDXRKSG-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.62 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|