C28H22N4OS — CID 27153620
[(R)-(3-oxo-4H-quinoxalin-2-yl)-phenylmethyl] N,N'-diphenylcarbamimidothioate (PubChem CID 27153620) has the molecular formula C28H22N4OS and a molecular weight of 462.58 g/mol. Its IUPAC name is [(R)-(3-oxo-4H-quinoxalin-2-yl)-phenylmethyl] N,N'-diphenylcarbamimidothioate.
| Compound Name | [(R)-(3-oxo-4H-quinoxalin-2-yl)-phenylmethyl] N,N'-diphenylcarbamimidothioate |
|---|---|
| PubChem CID | 27153620 |
| Molecular Formula | C28H22N4OS |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | [(R)-(3-oxo-4H-quinoxalin-2-yl)-phenylmethyl] N,N'-diphenylcarbamimidothioate |
| SMILES | O=c1[nH]c2ccccc2nc1[C@H](S/C(=N/c1ccccc1)Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H22N4OS/c33-27-25(31-23-18-10-11-19-24(23)32-27)26(20-12-4-1-5-13-20)34-28(29-21-14-6-2-7-15-21)30-22-16-8-3-9-17-22/h1-19,26H,(H,29,30)(H,32,33)/t26-/m1/s1 |
| InChIKey | DTBPMZJOWNUBGG-AREMUKBSSA-N |
| XLogP | 6.55 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|