C23H24N4OS — CID 10927602
benzyl N'-(4-methylphenyl)-N-[(4-methylphenyl)carbamoylamino]carbamimidothioate (PubChem CID 10927602) has the molecular formula C23H24N4OS and a molecular weight of 404.54 g/mol. Its IUPAC name is benzyl N'-(4-methylphenyl)-N-[(4-methylphenyl)carbamoylamino]carbamimidothioate.
| Compound Name | benzyl N'-(4-methylphenyl)-N-[(4-methylphenyl)carbamoylamino]carbamimidothioate |
|---|---|
| PubChem CID | 10927602 |
| Molecular Formula | C23H24N4OS |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | benzyl N'-(4-methylphenyl)-N-[(4-methylphenyl)carbamoylamino]carbamimidothioate |
| SMILES | Cc1ccc(/N=C(/NNC(=O)Nc2ccc(C)cc2)SCc2ccccc2)cc1 |
| InChI | InChI=1S/C23H24N4OS/c1-17-8-12-20(13-9-17)24-22(28)26-27-23(25-21-14-10-18(2)11-15-21)29-16-19-6-4-3-5-7-19/h3-15H,16H2,1-2H3,(H,25,27)(H2,24,26,28) |
| InChIKey | BDZWKRVMTVZFOF-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|