C20H22N2O2 — CID 150785821
2-acetyl-3-hydroxy-N,N'-bis(4-methylphenyl)but-2-enimidamide (PubChem CID 150785821) has the molecular formula C20H22N2O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is 2-acetyl-3-hydroxy-N,N'-bis(4-methylphenyl)but-2-enimidamide.
| Compound Name | 2-acetyl-3-hydroxy-N,N'-bis(4-methylphenyl)but-2-enimidamide |
|---|---|
| PubChem CID | 150785821 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 2-acetyl-3-hydroxy-N,N'-bis(4-methylphenyl)but-2-enimidamide |
| SMILES | CC(=O)C(=C(C)O)/C(=N\c1ccc(C)cc1)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C20H22N2O2/c1-13-5-9-17(10-6-13)21-20(19(15(3)23)16(4)24)22-18-11-7-14(2)8-12-18/h5-12,23H,1-4H3,(H,21,22) |
| InChIKey | XXEMZIGNECFXJS-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|