About 1-N,2-N-bis(4-fluorophenyl)-1-N',2-N'-bis(4-methylphenyl)ethanediimidamide
1-N,2-N-bis(4-fluorophenyl)-1-N',2-N'-bis(4-methylphenyl)ethanediimidamide (PubChem CID 4105169) has the molecular formula C28H24F2N4
and a molecular weight of 454.52 g/mol. Its IUPAC name is 1-N,2-N-bis(4-fluorophenyl)-1-N',2-N'-bis(4-methylphenyl)ethanediimidamide.
Molecular Properties
| Compound Name | 1-N,2-N-bis(4-fluorophenyl)-1-N',2-N'-bis(4-methylphenyl)ethanediimidamide |
| PubChem CID | 4105169 |
| Molecular Formula | C28H24F2N4 |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | 1-N,2-N-bis(4-fluorophenyl)-1-N',2-N'-bis(4-methylphenyl)ethanediimidamide |
| SMILES | Cc1ccc(/N=C(Nc2ccc(F)cc2)/C(=N\c2ccc(C)cc2)Nc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C28H24F2N4/c1-19-3-11-23(12-4-19)31-27(33-25-15-7-21(29)8-16-25)28(32-24-13-5-20(2)6-14-24)34-26-17-9-22(30)10-18-26/h3-18H,1-2H3,(H,31,33)(H,32,34) |
| InChIKey | OUGIMUCBBCWHST-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-N,2-N-bis(4-fluorophenyl)-1-N',2-N'-bis(4-methylphenyl)ethanediimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N,2-N-bis(4-fluorophenyl)-1-N',2-N'-bis(4-methylphenyl)ethanediimidamide?
The IUPAC name of 1-N,2-N-bis(4-fluorophenyl)-1-N',2-N'-bis(4-methylphenyl)ethanediimidamide (CID 4105169) is 1-N,2-N-bis(4-fluorophenyl)-1-N',2-N'-bis(4-methylphenyl)ethanediimidamide.
What is the SMILES notation for 1-N,2-N-bis(4-fluorophenyl)-1-N',2-N'-bis(4-methylphenyl)ethanediimidamide?
The canonical SMILES for 1-N,2-N-bis(4-fluorophenyl)-1-N',2-N'-bis(4-methylphenyl)ethanediimidamide is Cc1ccc(/N=C(Nc2ccc(F)cc2)/C(=N\c2ccc(C)cc2)Nc2ccc(F)cc2)cc1.
What is the InChIKey of 1-N,2-N-bis(4-fluorophenyl)-1-N',2-N'-bis(4-methylphenyl)ethanediimidamide?
The InChIKey is OUGIMUCBBCWHST-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H24F2N4/c1-19-3-11-23(12-4-19)31-27(33-25-15-7-21(29)8-16-25)28(32-24-13-5-20(2)6-14-24)34-26-17-9-22(30)10-18-26/h3-18H,1-2H3,(H,31,33)(H,32,34).
What are the key properties of 1-N,2-N-bis(4-fluorophenyl)-1-N',2-N'-bis(4-methylphenyl)ethanediimidamide?
1-N,2-N-bis(4-fluorophenyl)-1-N',2-N'-bis(4-methylphenyl)ethanediimidamide has a molecular weight of 454.52 g/mol, XLogP of 7.57, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N,2-N-bis(4-fluorophenyl)-1-N',2-N'-bis(4-methylphenyl)ethanediimidamide is sourced from PubChem (CID 4105169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).