About [N'-(4-methylphenyl)carbamimidoyl] N-(4-methylphenyl)carbamate
[N'-(4-methylphenyl)carbamimidoyl] N-(4-methylphenyl)carbamate (PubChem CID 68500642) has the molecular formula C16H17N3O2
and a molecular weight of 283.33 g/mol. Its IUPAC name is [N'-(4-methylphenyl)carbamimidoyl] N-(4-methylphenyl)carbamate.
Molecular Properties
| Compound Name | [N'-(4-methylphenyl)carbamimidoyl] N-(4-methylphenyl)carbamate |
| PubChem CID | 68500642 |
| Molecular Formula | C16H17N3O2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | [N'-(4-methylphenyl)carbamimidoyl] N-(4-methylphenyl)carbamate |
| SMILES | Cc1ccc(/N=C(\N)OC(=O)Nc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C16H17N3O2/c1-11-3-7-13(8-4-11)18-15(17)21-16(20)19-14-9-5-12(2)6-10-14/h3-10H,1-2H3,(H2,17,18)(H,19,20) |
| InChIKey | XMVDETLDFKFMRF-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze [N'-(4-methylphenyl)carbamimidoyl] N-(4-methylphenyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [N'-(4-methylphenyl)carbamimidoyl] N-(4-methylphenyl)carbamate?
The IUPAC name of [N'-(4-methylphenyl)carbamimidoyl] N-(4-methylphenyl)carbamate (CID 68500642) is [N'-(4-methylphenyl)carbamimidoyl] N-(4-methylphenyl)carbamate.
What is the SMILES notation for [N'-(4-methylphenyl)carbamimidoyl] N-(4-methylphenyl)carbamate?
The canonical SMILES for [N'-(4-methylphenyl)carbamimidoyl] N-(4-methylphenyl)carbamate is Cc1ccc(/N=C(\N)OC(=O)Nc2ccc(C)cc2)cc1.
What is the InChIKey of [N'-(4-methylphenyl)carbamimidoyl] N-(4-methylphenyl)carbamate?
The InChIKey is XMVDETLDFKFMRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N3O2/c1-11-3-7-13(8-4-11)18-15(17)21-16(20)19-14-9-5-12(2)6-10-14/h3-10H,1-2H3,(H2,17,18)(H,19,20).
What are the key properties of [N'-(4-methylphenyl)carbamimidoyl] N-(4-methylphenyl)carbamate?
[N'-(4-methylphenyl)carbamimidoyl] N-(4-methylphenyl)carbamate has a molecular weight of 283.33 g/mol, XLogP of 3.50, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [N'-(4-methylphenyl)carbamimidoyl] N-(4-methylphenyl)carbamate is sourced from PubChem (CID 68500642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).