About [N'-(4-methylphenyl)carbamimidoyl]urea
[N'-(4-methylphenyl)carbamimidoyl]urea (PubChem CID 135406039) has the molecular formula C9H12N4O
and a molecular weight of 192.22 g/mol. Its IUPAC name is [N'-(4-methylphenyl)carbamimidoyl]urea.
Molecular Properties
| Compound Name | [N'-(4-methylphenyl)carbamimidoyl]urea |
| PubChem CID | 135406039 |
| Molecular Formula | C9H12N4O |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | [N'-(4-methylphenyl)carbamimidoyl]urea |
| SMILES | Cc1ccc(/N=C(\N)NC(N)=O)cc1 |
| InChI | InChI=1S/C9H12N4O/c1-6-2-4-7(5-3-6)12-8(10)13-9(11)14/h2-5H,1H3,(H5,10,11,12,13,14) |
| InChIKey | FODKHECPYAUJID-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze [N'-(4-methylphenyl)carbamimidoyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [N'-(4-methylphenyl)carbamimidoyl]urea?
The IUPAC name of [N'-(4-methylphenyl)carbamimidoyl]urea (CID 135406039) is [N'-(4-methylphenyl)carbamimidoyl]urea.
What is the SMILES notation for [N'-(4-methylphenyl)carbamimidoyl]urea?
The canonical SMILES for [N'-(4-methylphenyl)carbamimidoyl]urea is Cc1ccc(/N=C(\N)NC(N)=O)cc1.
What is the InChIKey of [N'-(4-methylphenyl)carbamimidoyl]urea?
The InChIKey is FODKHECPYAUJID-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N4O/c1-6-2-4-7(5-3-6)12-8(10)13-9(11)14/h2-5H,1H3,(H5,10,11,12,13,14).
What are the key properties of [N'-(4-methylphenyl)carbamimidoyl]urea?
[N'-(4-methylphenyl)carbamimidoyl]urea has a molecular weight of 192.22 g/mol, XLogP of 0.61, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [N'-(4-methylphenyl)carbamimidoyl]urea is sourced from PubChem (CID 135406039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).