C9H12N4O — CID 135406039
[N'-(4-methylphenyl)carbamimidoyl]urea (PubChem CID 135406039) has the molecular formula C9H12N4O and a molecular weight of 192.22 g/mol. Its IUPAC name is [N'-(4-methylphenyl)carbamimidoyl]urea.
| Compound Name | [N'-(4-methylphenyl)carbamimidoyl]urea |
|---|---|
| PubChem CID | 135406039 |
| Molecular Formula | C9H12N4O |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | [N'-(4-methylphenyl)carbamimidoyl]urea |
| SMILES | Cc1ccc(/N=C(\N)NC(N)=O)cc1 |
| InChI | InChI=1S/C9H12N4O/c1-6-2-4-7(5-3-6)12-8(10)13-9(11)14/h2-5H,1H3,(H5,10,11,12,13,14) |
| InChIKey | FODKHECPYAUJID-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|