C13H20ClN5O2 — CID 135875121
4-[[amino-(carbamoylamino)methylidene]amino]-N,N-diethylbenzamide;hydrochloride (PubChem CID 135875121) has the molecular formula C13H20ClN5O2 and a molecular weight of 313.79 g/mol. Its IUPAC name is 4-[[amino-(carbamoylamino)methylidene]amino]-N,N-diethylbenzamide;hydrochloride.
| Compound Name | 4-[[amino-(carbamoylamino)methylidene]amino]-N,N-diethylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 135875121 |
| Molecular Formula | C13H20ClN5O2 |
| Molecular Weight | 313.79 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 4-[[amino-(carbamoylamino)methylidene]amino]-N,N-diethylbenzamide;hydrochloride |
| SMILES | CCN(CC)C(=O)c1ccc(/N=C(\N)NC(N)=O)cc1.Cl |
| InChI | InChI=1S/C13H19N5O2.ClH/c1-3-18(4-2)11(19)9-5-7-10(8-6-9)16-12(14)17-13(15)20;/h5-8H,3-4H2,1-2H3,(H5,14,15,16,17,20);1H |
| InChIKey | SPFXMBHCVHSTJN-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.79 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|