About azane;2-(4-methylphenyl)guanidine
azane;2-(4-methylphenyl)guanidine (PubChem CID 172751004) has the molecular formula C8H14N4
and a molecular weight of 166.23 g/mol. Its IUPAC name is azane;2-(4-methylphenyl)guanidine.
Molecular Properties
| Compound Name | azane;2-(4-methylphenyl)guanidine |
| PubChem CID | 172751004 |
| Molecular Formula | C8H14N4 |
| Molecular Weight | 166.23 g/mol |
| Exact Mass | 166.12 |
| IUPAC Name | azane;2-(4-methylphenyl)guanidine |
| SMILES | Cc1ccc(N=C(N)N)cc1.N |
| InChI | InChI=1S/C8H11N3.H3N/c1-6-2-4-7(5-3-6)11-8(9)10;/h2-5H,1H3,(H4,9,10,11);1H3 |
| InChIKey | KJHIGGMMVRDVAZ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 99.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.23 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze azane;2-(4-methylphenyl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2-(4-methylphenyl)guanidine?
The IUPAC name of azane;2-(4-methylphenyl)guanidine (CID 172751004) is azane;2-(4-methylphenyl)guanidine.
What is the SMILES notation for azane;2-(4-methylphenyl)guanidine?
The canonical SMILES for azane;2-(4-methylphenyl)guanidine is Cc1ccc(N=C(N)N)cc1.N.
What is the InChIKey of azane;2-(4-methylphenyl)guanidine?
The InChIKey is KJHIGGMMVRDVAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3.H3N/c1-6-2-4-7(5-3-6)11-8(9)10;/h2-5H,1H3,(H4,9,10,11);1H3.
What are the key properties of azane;2-(4-methylphenyl)guanidine?
azane;2-(4-methylphenyl)guanidine has a molecular weight of 166.23 g/mol, XLogP of 1.06, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2-(4-methylphenyl)guanidine is sourced from PubChem (CID 172751004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).