C9H16Cl2N4 — CID 52944141
2-[4-(dimethylamino)phenyl]guanidine;dihydrochloride (PubChem CID 52944141) has the molecular formula C9H16Cl2N4 and a molecular weight of 251.16 g/mol. Its IUPAC name is 2-[4-(dimethylamino)phenyl]guanidine;dihydrochloride.
| Compound Name | 2-[4-(dimethylamino)phenyl]guanidine;dihydrochloride |
|---|---|
| PubChem CID | 52944141 |
| Molecular Formula | C9H16Cl2N4 |
| Molecular Weight | 251.16 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 2-[4-(dimethylamino)phenyl]guanidine;dihydrochloride |
| SMILES | CN(C)c1ccc(N=C(N)N)cc1.Cl.Cl |
| InChI | InChI=1S/C9H14N4.2ClH/c1-13(2)8-5-3-7(4-6-8)12-9(10)11;;/h3-6H,1-2H3,(H4,10,11,12);2*1H |
| InChIKey | DDNWYCVICZQCJT-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.16 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|