C19H25N5S2 — CID 56836457
3-(N'-phenylcarbamimidoyl)sulfanylpropyl N'-[4-(dimethylamino)phenyl]carbamimidothioate (PubChem CID 56836457) has the molecular formula C19H25N5S2 and a molecular weight of 387.58 g/mol. Its IUPAC name is 3-(N'-phenylcarbamimidoyl)sulfanylpropyl N'-[4-(dimethylamino)phenyl]carbamimidothioate.
| Compound Name | 3-(N'-phenylcarbamimidoyl)sulfanylpropyl N'-[4-(dimethylamino)phenyl]carbamimidothioate |
|---|---|
| PubChem CID | 56836457 |
| Molecular Formula | C19H25N5S2 |
| Molecular Weight | 387.58 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 3-(N'-phenylcarbamimidoyl)sulfanylpropyl N'-[4-(dimethylamino)phenyl]carbamimidothioate |
| SMILES | CN(C)c1ccc(/N=C(/N)SCCCS/C(N)=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C19H25N5S2/c1-24(2)17-11-9-16(10-12-17)23-19(21)26-14-6-13-25-18(20)22-15-7-4-3-5-8-15/h3-5,7-12H,6,13-14H2,1-2H3,(H2,20,22)(H2,21,23) |
| InChIKey | OWBGCGOSIIJLMN-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.58 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|