C22H23N5 — CID 10043892
1-[(E)-[[4-(dimethylamino)phenyl]-phenylmethylidene]amino]-2-phenylguanidine (PubChem CID 10043892) has the molecular formula C22H23N5 and a molecular weight of 357.46 g/mol. Its IUPAC name is 1-[(E)-[[4-(dimethylamino)phenyl]-phenylmethylidene]amino]-2-phenylguanidine.
| Compound Name | 1-[(E)-[[4-(dimethylamino)phenyl]-phenylmethylidene]amino]-2-phenylguanidine |
|---|---|
| PubChem CID | 10043892 |
| Molecular Formula | C22H23N5 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.20 |
| IUPAC Name | 1-[(E)-[[4-(dimethylamino)phenyl]-phenylmethylidene]amino]-2-phenylguanidine |
| SMILES | CN(C)c1ccc(/C(=N/N/C(N)=N/c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H23N5/c1-27(2)20-15-13-18(14-16-20)21(17-9-5-3-6-10-17)25-26-22(23)24-19-11-7-4-8-12-19/h3-16H,1-2H3,(H3,23,24,26)/b25-21+ |
| InChIKey | TYDMJJMQGZXJEY-NJNXFGOHSA-N |
| XLogP | 3.74 |
| TPSA | 66.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|