C22H23N5O3S — CID 10003202
2-(dimethylamino)-5-[(E)-C-phenyl-N-[(N'-phenylcarbamimidoyl)amino]carbonimidoyl]benzenesulfonic acid (PubChem CID 10003202) has the molecular formula C22H23N5O3S and a molecular weight of 437.53 g/mol. Its IUPAC name is 2-(dimethylamino)-5-[(E)-C-phenyl-N-[(N'-phenylcarbamimidoyl)amino]carbonimidoyl]benzenesulfonic acid.
| Compound Name | 2-(dimethylamino)-5-[(E)-C-phenyl-N-[(N'-phenylcarbamimidoyl)amino]carbonimidoyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 10003202 |
| Molecular Formula | C22H23N5O3S |
| Molecular Weight | 437.53 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | 2-(dimethylamino)-5-[(E)-C-phenyl-N-[(N'-phenylcarbamimidoyl)amino]carbonimidoyl]benzenesulfonic acid |
| SMILES | CN(C)c1ccc(/C(=N/N/C(N)=N/c2ccccc2)c2ccccc2)cc1S(=O)(=O)O |
| InChI | InChI=1S/C22H23N5O3S/c1-27(2)19-14-13-17(15-20(19)31(28,29)30)21(16-9-5-3-6-10-16)25-26-22(23)24-18-11-7-4-8-12-18/h3-15H,1-2H3,(H3,23,24,26)(H,28,29,30)/b25-21+ |
| InChIKey | PLZGYFBRGDIHLZ-NJNXFGOHSA-N |
| XLogP | 2.99 |
| TPSA | 120.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.53 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|