About [[(3,4-dichlorophenyl)-phenylmethylidene]amino]urea
[[(3,4-dichlorophenyl)-phenylmethylidene]amino]urea (PubChem CID 3249905) has the molecular formula C14H11Cl2N3O
and a molecular weight of 308.17 g/mol. Its IUPAC name is [[(3,4-dichlorophenyl)-phenylmethylidene]amino]urea.
Molecular Properties
| Compound Name | [[(3,4-dichlorophenyl)-phenylmethylidene]amino]urea |
| PubChem CID | 3249905 |
| Molecular Formula | C14H11Cl2N3O |
| Molecular Weight | 308.17 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | [[(3,4-dichlorophenyl)-phenylmethylidene]amino]urea |
| SMILES | NC(=O)NN=C(c1ccccc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H11Cl2N3O/c15-11-7-6-10(8-12(11)16)13(18-19-14(17)20)9-4-2-1-3-5-9/h1-8H,(H3,17,19,20) |
| InChIKey | RHPDZIURFDSKAN-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.17 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [[(3,4-dichlorophenyl)-phenylmethylidene]amino]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[(3,4-dichlorophenyl)-phenylmethylidene]amino]urea?
The IUPAC name of [[(3,4-dichlorophenyl)-phenylmethylidene]amino]urea (CID 3249905) is [[(3,4-dichlorophenyl)-phenylmethylidene]amino]urea.
What is the SMILES notation for [[(3,4-dichlorophenyl)-phenylmethylidene]amino]urea?
The canonical SMILES for [[(3,4-dichlorophenyl)-phenylmethylidene]amino]urea is NC(=O)NN=C(c1ccccc1)c1ccc(Cl)c(Cl)c1.
What is the InChIKey of [[(3,4-dichlorophenyl)-phenylmethylidene]amino]urea?
The InChIKey is RHPDZIURFDSKAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11Cl2N3O/c15-11-7-6-10(8-12(11)16)13(18-19-14(17)20)9-4-2-1-3-5-9/h1-8H,(H3,17,19,20).
What are the key properties of [[(3,4-dichlorophenyl)-phenylmethylidene]amino]urea?
[[(3,4-dichlorophenyl)-phenylmethylidene]amino]urea has a molecular weight of 308.17 g/mol, XLogP of 3.41, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [[(3,4-dichlorophenyl)-phenylmethylidene]amino]urea is sourced from PubChem (CID 3249905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).