C42H36N6O3S2 — CID 158596091
aminothiourea;(4-benzoylphenyl)-phenylmethanone;[[(4-benzoylphenyl)-phenylmethylidene]amino]thiourea (PubChem CID 158596091) has the molecular formula C42H36N6O3S2 and a molecular weight of 736.92 g/mol. Its IUPAC name is aminothiourea;(4-benzoylphenyl)-phenylmethanone;[[(4-benzoylphenyl)-phenylmethylidene]amino]thiourea.
| Compound Name | aminothiourea;(4-benzoylphenyl)-phenylmethanone;[[(4-benzoylphenyl)-phenylmethylidene]amino]thiourea |
|---|---|
| PubChem CID | 158596091 |
| Molecular Formula | C42H36N6O3S2 |
| Molecular Weight | 736.92 g/mol |
| Exact Mass | 736.23 |
| IUPAC Name | aminothiourea;(4-benzoylphenyl)-phenylmethanone;[[(4-benzoylphenyl)-phenylmethylidene]amino]thiourea |
| SMILES | NC(=S)NN=C(c1ccccc1)c1ccc(C(=O)c2ccccc2)cc1.NNC(N)=S.O=C(c1ccccc1)c1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H17N3OS.C20H14O2.CH5N3S/c22-21(26)24-23-19(15-7-3-1-4-8-15)16-11-13-18(14-12-16)20(25)17-9-5-2-6-10-17;21-19(15-7-3-1-4-8-15)17-11-13-18(14-12-17)20(22)16-9-5-2-6-10-16;2-1(5)4-3/h1-14H,(H3,22,24,26);1-14H;3H2,(H3,2,4,5) |
| InChIKey | HVASQUKGMBQYNN-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 165.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.92 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|