C15H15N3S — CID 52945875
[(E)-1,2-diphenylethylideneamino]thiourea (PubChem CID 52945875) has the molecular formula C15H15N3S and a molecular weight of 269.37 g/mol. Its IUPAC name is [(E)-1,2-diphenylethylideneamino]thiourea.
| Compound Name | [(E)-1,2-diphenylethylideneamino]thiourea |
|---|---|
| PubChem CID | 52945875 |
| Molecular Formula | C15H15N3S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | [(E)-1,2-diphenylethylideneamino]thiourea |
| SMILES | NC(=S)N/N=C(\Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H15N3S/c16-15(19)18-17-14(13-9-5-2-6-10-13)11-12-7-3-1-4-8-12/h1-10H,11H2,(H3,16,18,19)/b17-14+ |
| InChIKey | WHRFFXUXTGIZOH-SAPNQHFASA-N |
| XLogP | 2.47 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|