C19H22AsN3OS — CID 173316009
[(Z)-[1-phenyl-2-(2-phenylacetyl)arsanylbutylidene]amino]thiourea (PubChem CID 173316009) has the molecular formula C19H22AsN3OS and a molecular weight of 415.39 g/mol. Its IUPAC name is [(Z)-[1-phenyl-2-(2-phenylacetyl)arsanylbutylidene]amino]thiourea.
| Compound Name | [(Z)-[1-phenyl-2-(2-phenylacetyl)arsanylbutylidene]amino]thiourea |
|---|---|
| PubChem CID | 173316009 |
| Molecular Formula | C19H22AsN3OS |
| Molecular Weight | 415.39 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | [(Z)-[1-phenyl-2-(2-phenylacetyl)arsanylbutylidene]amino]thiourea |
| SMILES | CCC([AsH]C(=O)Cc1ccccc1)/C(=N\NC(N)=S)c1ccccc1 |
| InChI | InChI=1S/C19H22AsN3OS/c1-2-16(20-17(24)13-14-9-5-3-6-10-14)18(22-23-19(21)25)15-11-7-4-8-12-15/h3-12,16,20H,2,13H2,1H3,(H3,21,23,25)/b22-18- |
| InChIKey | UBZGJOFVPOCSTA-PYCFMQQDSA-N |
| XLogP | 2.63 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.39 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|