C13H18N4OS — CID 54332763
N-[2-(carbamothioylhydrazinylidene)-2-phenylethyl]-2-methylpropanamide (PubChem CID 54332763) has the molecular formula C13H18N4OS and a molecular weight of 278.38 g/mol. Its IUPAC name is N-[2-(carbamothioylhydrazinylidene)-2-phenylethyl]-2-methylpropanamide.
| Compound Name | N-[2-(carbamothioylhydrazinylidene)-2-phenylethyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 54332763 |
| Molecular Formula | C13H18N4OS |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | N-[2-(carbamothioylhydrazinylidene)-2-phenylethyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)NCC(=NNC(N)=S)c1ccccc1 |
| InChI | InChI=1S/C13H18N4OS/c1-9(2)12(18)15-8-11(16-17-13(14)19)10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3,(H,15,18)(H3,14,17,19) |
| InChIKey | SZMMIXLCCSWYCD-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|