C13H18N4O2S — CID 173311455
[4-(carbamothioylhydrazinylidene)-2-methyl-4-phenylbutyl] carbamate (PubChem CID 173311455) has the molecular formula C13H18N4O2S and a molecular weight of 294.38 g/mol. Its IUPAC name is [4-(carbamothioylhydrazinylidene)-2-methyl-4-phenylbutyl] carbamate.
| Compound Name | [4-(carbamothioylhydrazinylidene)-2-methyl-4-phenylbutyl] carbamate |
|---|---|
| PubChem CID | 173311455 |
| Molecular Formula | C13H18N4O2S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | [4-(carbamothioylhydrazinylidene)-2-methyl-4-phenylbutyl] carbamate |
| SMILES | CC(COC(N)=O)CC(=NNC(N)=S)c1ccccc1 |
| InChI | InChI=1S/C13H18N4O2S/c1-9(8-19-13(15)18)7-11(16-17-12(14)20)10-5-3-2-4-6-10/h2-6,9H,7-8H2,1H3,(H2,15,18)(H3,14,17,20) |
| InChIKey | PQLZXFPPSYCRHN-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|