C19H18N4O2S — CID 122197311
(4Z)-4-(carbamothioylhydrazinylidene)-2-(1H-indol-3-yl)-4-phenylbutanoic acid (PubChem CID 122197311) has the molecular formula C19H18N4O2S and a molecular weight of 366.45 g/mol. Its IUPAC name is (4Z)-4-(carbamothioylhydrazinylidene)-2-(1H-indol-3-yl)-4-phenylbutanoic acid.
| Compound Name | (4Z)-4-(carbamothioylhydrazinylidene)-2-(1H-indol-3-yl)-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 122197311 |
| Molecular Formula | C19H18N4O2S |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | (4Z)-4-(carbamothioylhydrazinylidene)-2-(1H-indol-3-yl)-4-phenylbutanoic acid |
| SMILES | NC(=S)N/N=C(/CC(C(=O)O)c1c[nH]c2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C19H18N4O2S/c20-19(26)23-22-17(12-6-2-1-3-7-12)10-14(18(24)25)15-11-21-16-9-5-4-8-13(15)16/h1-9,11,14,21H,10H2,(H,24,25)(H3,20,23,26)/b22-17- |
| InChIKey | YXSYGQITWVVSLC-XLNRJJMWSA-N |
| XLogP | 2.96 |
| TPSA | 103.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|