C20H19NO3 — CID 13077495
4-(2,5-dimethylphenyl)-2-(1H-indol-3-yl)-4-oxobutanoic acid (PubChem CID 13077495) has the molecular formula C20H19NO3 and a molecular weight of 321.38 g/mol. Its IUPAC name is 4-(2,5-dimethylphenyl)-2-(1H-indol-3-yl)-4-oxobutanoic acid.
| Compound Name | 4-(2,5-dimethylphenyl)-2-(1H-indol-3-yl)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 13077495 |
| Molecular Formula | C20H19NO3 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 4-(2,5-dimethylphenyl)-2-(1H-indol-3-yl)-4-oxobutanoic acid |
| SMILES | Cc1ccc(C)c(C(=O)CC(C(=O)O)c2c[nH]c3ccccc23)c1 |
| InChI | InChI=1S/C20H19NO3/c1-12-7-8-13(2)15(9-12)19(22)10-16(20(23)24)17-11-21-18-6-4-3-5-14(17)18/h3-9,11,16,21H,10H2,1-2H3,(H,23,24) |
| InChIKey | VGLRSRLNQTVXRL-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |