C20H18FNO3 — CID 147786619
4-(2,4-dimethylphenyl)-2-(6-fluoro-1H-indol-3-yl)-4-oxobutanoic acid (PubChem CID 147786619) has the molecular formula C20H18FNO3 and a molecular weight of 339.37 g/mol. Its IUPAC name is 4-(2,4-dimethylphenyl)-2-(6-fluoro-1H-indol-3-yl)-4-oxobutanoic acid.
| Compound Name | 4-(2,4-dimethylphenyl)-2-(6-fluoro-1H-indol-3-yl)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 147786619 |
| Molecular Formula | C20H18FNO3 |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 4-(2,4-dimethylphenyl)-2-(6-fluoro-1H-indol-3-yl)-4-oxobutanoic acid |
| SMILES | Cc1ccc(C(=O)CC(C(=O)O)c2c[nH]c3cc(F)ccc23)c(C)c1 |
| InChI | InChI=1S/C20H18FNO3/c1-11-3-5-14(12(2)7-11)19(23)9-16(20(24)25)17-10-22-18-8-13(21)4-6-15(17)18/h3-8,10,16,22H,9H2,1-2H3,(H,24,25) |
| InChIKey | HIUSHJGOOXJRSX-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |