C10H8FNO3 — CID 115073431
2-(6-fluoro-1H-indol-3-yl)-2-hydroxyacetic acid (PubChem CID 115073431) has the molecular formula C10H8FNO3 and a molecular weight of 209.18 g/mol. Its IUPAC name is 2-(6-fluoro-1H-indol-3-yl)-2-hydroxyacetic acid.
| Compound Name | 2-(6-fluoro-1H-indol-3-yl)-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 115073431 |
| Molecular Formula | C10H8FNO3 |
| Molecular Weight | 209.18 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | 2-(6-fluoro-1H-indol-3-yl)-2-hydroxyacetic acid |
| SMILES | O=C(O)C(O)c1c[nH]c2cc(F)ccc12 |
| InChI | InChI=1S/C10H8FNO3/c11-5-1-2-6-7(9(13)10(14)15)4-12-8(6)3-5/h1-4,9,12-13H,(H,14,15) |
| InChIKey | XPYMCCGXOYXBRX-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.18 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |