C12H12FNO4 — CID 171865464
methyl 3-(6-fluoro-1H-indol-3-yl)-2,3-dihydroxypropanoate (PubChem CID 171865464) has the molecular formula C12H12FNO4 and a molecular weight of 253.23 g/mol. Its IUPAC name is methyl 3-(6-fluoro-1H-indol-3-yl)-2,3-dihydroxypropanoate.
| Compound Name | methyl 3-(6-fluoro-1H-indol-3-yl)-2,3-dihydroxypropanoate |
|---|---|
| PubChem CID | 171865464 |
| Molecular Formula | C12H12FNO4 |
| Molecular Weight | 253.23 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | methyl 3-(6-fluoro-1H-indol-3-yl)-2,3-dihydroxypropanoate |
| SMILES | COC(=O)C(O)C(O)c1c[nH]c2cc(F)ccc12 |
| InChI | InChI=1S/C12H12FNO4/c1-18-12(17)11(16)10(15)8-5-14-9-4-6(13)2-3-7(8)9/h2-5,10-11,14-16H,1H3 |
| InChIKey | XAUYLQUZUGSOSA-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.23 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |