C13H14BrNO4 — CID 171861364
methyl 3-(3-bromo-1,2-dihydroxypropyl)-1H-indole-6-carboxylate (PubChem CID 171861364) has the molecular formula C13H14BrNO4 and a molecular weight of 328.16 g/mol. Its IUPAC name is methyl 3-(3-bromo-1,2-dihydroxypropyl)-1H-indole-6-carboxylate.
| Compound Name | methyl 3-(3-bromo-1,2-dihydroxypropyl)-1H-indole-6-carboxylate |
|---|---|
| PubChem CID | 171861364 |
| Molecular Formula | C13H14BrNO4 |
| Molecular Weight | 328.16 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | methyl 3-(3-bromo-1,2-dihydroxypropyl)-1H-indole-6-carboxylate |
| SMILES | COC(=O)c1ccc2c(C(O)C(O)CBr)c[nH]c2c1 |
| InChI | InChI=1S/C13H14BrNO4/c1-19-13(18)7-2-3-8-9(6-15-10(8)4-7)12(17)11(16)5-14/h2-4,6,11-12,15-17H,5H2,1H3 |
| InChIKey | UQLHFTZACGRKEY-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.16 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|