C12H15BrO5 — CID 171893160
methyl 4-(4-bromo-1,2-dihydroxybutyl)-3-hydroxybenzoate (PubChem CID 171893160) has the molecular formula C12H15BrO5 and a molecular weight of 319.15 g/mol. Its IUPAC name is methyl 4-(4-bromo-1,2-dihydroxybutyl)-3-hydroxybenzoate.
| Compound Name | methyl 4-(4-bromo-1,2-dihydroxybutyl)-3-hydroxybenzoate |
|---|---|
| PubChem CID | 171893160 |
| Molecular Formula | C12H15BrO5 |
| Molecular Weight | 319.15 g/mol |
| Exact Mass | 318.01 |
| IUPAC Name | methyl 4-(4-bromo-1,2-dihydroxybutyl)-3-hydroxybenzoate |
| SMILES | COC(=O)c1ccc(C(O)C(O)CCBr)c(O)c1 |
| InChI | InChI=1S/C12H15BrO5/c1-18-12(17)7-2-3-8(10(15)6-7)11(16)9(14)4-5-13/h2-3,6,9,11,14-16H,4-5H2,1H3 |
| InChIKey | URGSAJDVMFIQNU-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.15 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|