C11H11FO6 — CID 171864337
2-(1,2-dihydroxy-3-methoxy-3-oxopropyl)-4-fluorobenzoic acid (PubChem CID 171864337) has the molecular formula C11H11FO6 and a molecular weight of 258.20 g/mol. Its IUPAC name is 2-(1,2-dihydroxy-3-methoxy-3-oxopropyl)-4-fluorobenzoic acid.
| Compound Name | 2-(1,2-dihydroxy-3-methoxy-3-oxopropyl)-4-fluorobenzoic acid |
|---|---|
| PubChem CID | 171864337 |
| Molecular Formula | C11H11FO6 |
| Molecular Weight | 258.20 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | 2-(1,2-dihydroxy-3-methoxy-3-oxopropyl)-4-fluorobenzoic acid |
| SMILES | COC(=O)C(O)C(O)c1cc(F)ccc1C(=O)O |
| InChI | InChI=1S/C11H11FO6/c1-18-11(17)9(14)8(13)7-4-5(12)2-3-6(7)10(15)16/h2-4,8-9,13-14H,1H3,(H,15,16) |
| InChIKey | BJNIDDILPMIXNY-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.20 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |