C11H12ClNO6 — CID 171864715
2-amino-5-chloro-3-(1,2-dihydroxy-3-methoxy-3-oxopropyl)benzoic acid (PubChem CID 171864715) has the molecular formula C11H12ClNO6 and a molecular weight of 289.67 g/mol. Its IUPAC name is 2-amino-5-chloro-3-(1,2-dihydroxy-3-methoxy-3-oxopropyl)benzoic acid.
| Compound Name | 2-amino-5-chloro-3-(1,2-dihydroxy-3-methoxy-3-oxopropyl)benzoic acid |
|---|---|
| PubChem CID | 171864715 |
| Molecular Formula | C11H12ClNO6 |
| Molecular Weight | 289.67 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | 2-amino-5-chloro-3-(1,2-dihydroxy-3-methoxy-3-oxopropyl)benzoic acid |
| SMILES | COC(=O)C(O)C(O)c1cc(Cl)cc(C(=O)O)c1N |
| InChI | InChI=1S/C11H12ClNO6/c1-19-11(18)9(15)8(14)5-2-4(12)3-6(7(5)13)10(16)17/h2-3,8-9,14-15H,13H2,1H3,(H,16,17) |
| InChIKey | BXBAGPLWKVVHQM-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.67 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|