C19H15F2NO4 — CID 139328118
4-(2,4-difluorophenyl)-2-(5-methoxy-1H-indol-3-yl)-4-oxobutanoic acid (PubChem CID 139328118) has the molecular formula C19H15F2NO4 and a molecular weight of 359.33 g/mol. Its IUPAC name is 4-(2,4-difluorophenyl)-2-(5-methoxy-1H-indol-3-yl)-4-oxobutanoic acid.
| Compound Name | 4-(2,4-difluorophenyl)-2-(5-methoxy-1H-indol-3-yl)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 139328118 |
| Molecular Formula | C19H15F2NO4 |
| Molecular Weight | 359.33 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | 4-(2,4-difluorophenyl)-2-(5-methoxy-1H-indol-3-yl)-4-oxobutanoic acid |
| SMILES | COc1ccc2[nH]cc(C(CC(=O)c3ccc(F)cc3F)C(=O)O)c2c1 |
| InChI | InChI=1S/C19H15F2NO4/c1-26-11-3-5-17-13(7-11)15(9-22-17)14(19(24)25)8-18(23)12-4-2-10(20)6-16(12)21/h2-7,9,14,22H,8H2,1H3,(H,24,25) |
| InChIKey | PPPFOINQKKKMKK-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 79.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.33 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |