C36H24Cl2F4N2O6 — CID 159189108
5-chloro-1H-indole;2-(5-chloro-1H-indol-3-yl)-4-(2,4-difluorophenyl)-4-oxobutanoic acid;[(E)-3-(2,4-difluorophenyl)-3-oxoprop-1-enyl] formate (PubChem CID 159189108) has the molecular formula C36H24Cl2F4N2O6 and a molecular weight of 727.49 g/mol. Its IUPAC name is 5-chloro-1H-indole;2-(5-chloro-1H-indol-3-yl)-4-(2,4-difluorophenyl)-4-oxobutanoic acid;[(E)-3-(2,4-difluorophenyl)-3-oxoprop-1-enyl] formate.
| Compound Name | 5-chloro-1H-indole;2-(5-chloro-1H-indol-3-yl)-4-(2,4-difluorophenyl)-4-oxobutanoic acid;[(E)-3-(2,4-difluorophenyl)-3-oxoprop-1-enyl] formate |
|---|---|
| PubChem CID | 159189108 |
| Molecular Formula | C36H24Cl2F4N2O6 |
| Molecular Weight | 727.49 g/mol |
| Exact Mass | 726.09 |
| IUPAC Name | 5-chloro-1H-indole;2-(5-chloro-1H-indol-3-yl)-4-(2,4-difluorophenyl)-4-oxobutanoic acid;[(E)-3-(2,4-difluorophenyl)-3-oxoprop-1-enyl] formate |
| SMILES | Clc1ccc2[nH]ccc2c1.O=C(CC(C(=O)O)c1c[nH]c2ccc(Cl)cc12)c1ccc(F)cc1F.O=CO/C=C/C(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C18H12ClF2NO3.C10H6F2O3.C8H6ClN/c19-9-1-4-16-12(5-9)14(8-22-16)13(18(24)25)7-17(23)11-3-2-10(20)6-15(11)21;11-7-1-2-8(9(12)5-7)10(14)3-4-15-6-13;9-7-1-2-8-6(5-7)3-4-10-8/h1-6,8,13,22H,7H2,(H,24,25);1-6H;1-5,10H/b;4-3+; |
| InChIKey | KNVZVIKENNUKHN-ITDJAWRYSA-N |
| XLogP | 9.20 |
| TPSA | 129.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.49 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|