About benzoyl chloride;5-chloro-1H-indole;(5-chloro-1H-indol-3-yl)-phenylmethanone
benzoyl chloride;5-chloro-1H-indole;(5-chloro-1H-indol-3-yl)-phenylmethanone (PubChem CID 167538525) has the molecular formula C30H21Cl3N2O2
and a molecular weight of 547.87 g/mol. Its IUPAC name is benzoyl chloride;5-chloro-1H-indole;(5-chloro-1H-indol-3-yl)-phenylmethanone.
Molecular Properties
| Compound Name | benzoyl chloride;5-chloro-1H-indole;(5-chloro-1H-indol-3-yl)-phenylmethanone |
| PubChem CID | 167538525 |
| Molecular Formula | C30H21Cl3N2O2 |
| Molecular Weight | 547.87 g/mol |
| Exact Mass | 546.07 |
| IUPAC Name | benzoyl chloride;5-chloro-1H-indole;(5-chloro-1H-indol-3-yl)-phenylmethanone |
| SMILES | Clc1ccc2[nH]ccc2c1.O=C(Cl)c1ccccc1.O=C(c1ccccc1)c1c[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C15H10ClNO.C8H6ClN.C7H5ClO/c16-11-6-7-14-12(8-11)13(9-17-14)15(18)10-4-2-1-3-5-10;9-7-1-2-8-6(5-7)3-4-10-8;8-7(9)6-4-2-1-3-5-6/h1-9,17H;1-5,10H;1-5H |
| InChIKey | AWEVCPLJWWRXTQ-UHFFFAOYSA-N |
| XLogP | 8.94 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 547.87 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze benzoyl chloride;5-chloro-1H-indole;(5-chloro-1H-indol-3-yl)-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzoyl chloride;5-chloro-1H-indole;(5-chloro-1H-indol-3-yl)-phenylmethanone?
The IUPAC name of benzoyl chloride;5-chloro-1H-indole;(5-chloro-1H-indol-3-yl)-phenylmethanone (CID 167538525) is benzoyl chloride;5-chloro-1H-indole;(5-chloro-1H-indol-3-yl)-phenylmethanone.
What is the SMILES notation for benzoyl chloride;5-chloro-1H-indole;(5-chloro-1H-indol-3-yl)-phenylmethanone?
The canonical SMILES for benzoyl chloride;5-chloro-1H-indole;(5-chloro-1H-indol-3-yl)-phenylmethanone is Clc1ccc2[nH]ccc2c1.O=C(Cl)c1ccccc1.O=C(c1ccccc1)c1c[nH]c2ccc(Cl)cc12.
What is the InChIKey of benzoyl chloride;5-chloro-1H-indole;(5-chloro-1H-indol-3-yl)-phenylmethanone?
The InChIKey is AWEVCPLJWWRXTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10ClNO.C8H6ClN.C7H5ClO/c16-11-6-7-14-12(8-11)13(9-17-14)15(18)10-4-2-1-3-5-10;9-7-1-2-8-6(5-7)3-4-10-8;8-7(9)6-4-2-1-3-5-6/h1-9,17H;1-5,10H;1-5H.
What are the key properties of benzoyl chloride;5-chloro-1H-indole;(5-chloro-1H-indol-3-yl)-phenylmethanone?
benzoyl chloride;5-chloro-1H-indole;(5-chloro-1H-indol-3-yl)-phenylmethanone has a molecular weight of 547.87 g/mol, XLogP of 8.94, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzoyl chloride;5-chloro-1H-indole;(5-chloro-1H-indol-3-yl)-phenylmethanone is sourced from PubChem (CID 167538525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).