C15H7ClF3NO — CID 65101343
(5-chloro-1H-indol-3-yl)-(2,4,6-trifluorophenyl)methanone (PubChem CID 65101343) has the molecular formula C15H7ClF3NO and a molecular weight of 309.67 g/mol. Its IUPAC name is (5-chloro-1H-indol-3-yl)-(2,4,6-trifluorophenyl)methanone.
| Compound Name | (5-chloro-1H-indol-3-yl)-(2,4,6-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 65101343 |
| Molecular Formula | C15H7ClF3NO |
| Molecular Weight | 309.67 g/mol |
| Exact Mass | 309.02 |
| IUPAC Name | (5-chloro-1H-indol-3-yl)-(2,4,6-trifluorophenyl)methanone |
| SMILES | O=C(c1c(F)cc(F)cc1F)c1c[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C15H7ClF3NO/c16-7-1-2-13-9(3-7)10(6-20-13)15(21)14-11(18)4-8(17)5-12(14)19/h1-6,20H |
| InChIKey | QONUVGBMFRZZHB-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.67 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |