C15H8Cl3NO — CID 63877670
(5-chloro-1H-indol-3-yl)-(3,4-dichlorophenyl)methanone (PubChem CID 63877670) has the molecular formula C15H8Cl3NO and a molecular weight of 324.59 g/mol. Its IUPAC name is (5-chloro-1H-indol-3-yl)-(3,4-dichlorophenyl)methanone.
| Compound Name | (5-chloro-1H-indol-3-yl)-(3,4-dichlorophenyl)methanone |
|---|---|
| PubChem CID | 63877670 |
| Molecular Formula | C15H8Cl3NO |
| Molecular Weight | 324.59 g/mol |
| Exact Mass | 322.97 |
| IUPAC Name | (5-chloro-1H-indol-3-yl)-(3,4-dichlorophenyl)methanone |
| SMILES | O=C(c1ccc(Cl)c(Cl)c1)c1c[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C15H8Cl3NO/c16-9-2-4-14-10(6-9)11(7-19-14)15(20)8-1-3-12(17)13(18)5-8/h1-7,19H |
| InChIKey | XZQSTROBQHECRJ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.59 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |