C15H8ClF2NO — CID 63878183
(5-chloro-1H-indol-3-yl)-(3,5-difluorophenyl)methanone (PubChem CID 63878183) has the molecular formula C15H8ClF2NO and a molecular weight of 291.68 g/mol. Its IUPAC name is (5-chloro-1H-indol-3-yl)-(3,5-difluorophenyl)methanone.
| Compound Name | (5-chloro-1H-indol-3-yl)-(3,5-difluorophenyl)methanone |
|---|---|
| PubChem CID | 63878183 |
| Molecular Formula | C15H8ClF2NO |
| Molecular Weight | 291.68 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | (5-chloro-1H-indol-3-yl)-(3,5-difluorophenyl)methanone |
| SMILES | O=C(c1cc(F)cc(F)c1)c1c[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C15H8ClF2NO/c16-9-1-2-14-12(5-9)13(7-19-14)15(20)8-3-10(17)6-11(18)4-8/h1-7,19H |
| InChIKey | UMRLDXHFCOUYAH-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.68 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |