C18H16ClNO — CID 63878016
(5-chloro-1H-indol-3-yl)-(2,4,6-trimethylphenyl)methanone (PubChem CID 63878016) has the molecular formula C18H16ClNO and a molecular weight of 297.79 g/mol. Its IUPAC name is (5-chloro-1H-indol-3-yl)-(2,4,6-trimethylphenyl)methanone.
| Compound Name | (5-chloro-1H-indol-3-yl)-(2,4,6-trimethylphenyl)methanone |
|---|---|
| PubChem CID | 63878016 |
| Molecular Formula | C18H16ClNO |
| Molecular Weight | 297.79 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | (5-chloro-1H-indol-3-yl)-(2,4,6-trimethylphenyl)methanone |
| SMILES | Cc1cc(C)c(C(=O)c2c[nH]c3ccc(Cl)cc23)c(C)c1 |
| InChI | InChI=1S/C18H16ClNO/c1-10-6-11(2)17(12(3)7-10)18(21)15-9-20-16-5-4-13(19)8-14(15)16/h4-9,20H,1-3H3 |
| InChIKey | ICSXLRHPVYFLHI-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.79 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |