About CID 162765558
CID 162765558 (PubChem CID 162765558) has the molecular formula C13H15BClNO
and a molecular weight of 247.53 g/mol.
Molecular Properties
| Compound Name | CID 162765558 |
| PubChem CID | 162765558 |
| Molecular Formula | C13H15BClNO |
| Molecular Weight | 247.53 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | — |
| SMILES | CC.[B]C(C)C(=O)c1c[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C11H9BClNO.C2H6/c1-6(12)11(15)9-5-14-10-3-2-7(13)4-8(9)10;1-2/h2-6,14H,1H3;1-2H3 |
| InChIKey | TZJSZIQPAAZWSM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.53 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 162765558 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 162765558?
The IUPAC name of CID 162765558 (CID 162765558) is not available.
What is the SMILES notation for CID 162765558?
The canonical SMILES for CID 162765558 is CC.[B]C(C)C(=O)c1c[nH]c2ccc(Cl)cc12.
What is the InChIKey of CID 162765558?
The InChIKey is TZJSZIQPAAZWSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9BClNO.C2H6/c1-6(12)11(15)9-5-14-10-3-2-7(13)4-8(9)10;1-2/h2-6,14H,1H3;1-2H3.
What are the key properties of CID 162765558?
CID 162765558 has a molecular weight of 247.53 g/mol, XLogP of 4.01, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 162765558 is sourced from PubChem (CID 162765558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).