C15H8Br2ClNO — CID 107949887
(5-chloro-1H-indol-3-yl)-(2,4-dibromophenyl)methanone (PubChem CID 107949887) has the molecular formula C15H8Br2ClNO and a molecular weight of 413.50 g/mol. Its IUPAC name is (5-chloro-1H-indol-3-yl)-(2,4-dibromophenyl)methanone.
| Compound Name | (5-chloro-1H-indol-3-yl)-(2,4-dibromophenyl)methanone |
|---|---|
| PubChem CID | 107949887 |
| Molecular Formula | C15H8Br2ClNO |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 410.87 |
| IUPAC Name | (5-chloro-1H-indol-3-yl)-(2,4-dibromophenyl)methanone |
| SMILES | O=C(c1ccc(Br)cc1Br)c1c[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C15H8Br2ClNO/c16-8-1-3-10(13(17)5-8)15(20)12-7-19-14-4-2-9(18)6-11(12)14/h1-7,19H |
| InChIKey | RVGSVIYRMRSTHH-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |