C10H6F2O3 — CID 153411301
[(E)-3-(2,4-difluorophenyl)-3-oxoprop-1-enyl] formate (PubChem CID 153411301) has the molecular formula C10H6F2O3 and a molecular weight of 212.15 g/mol. Its IUPAC name is [(E)-3-(2,4-difluorophenyl)-3-oxoprop-1-enyl] formate.
| Compound Name | [(E)-3-(2,4-difluorophenyl)-3-oxoprop-1-enyl] formate |
|---|---|
| PubChem CID | 153411301 |
| Molecular Formula | C10H6F2O3 |
| Molecular Weight | 212.15 g/mol |
| Exact Mass | 212.03 |
| IUPAC Name | [(E)-3-(2,4-difluorophenyl)-3-oxoprop-1-enyl] formate |
| SMILES | O=CO/C=C/C(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C10H6F2O3/c11-7-1-2-8(9(12)5-7)10(14)3-4-15-6-13/h1-6H/b4-3+ |
| InChIKey | IPKQDTPWJVVVBP-ONEGZZNKSA-N |
| XLogP | 1.83 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.15 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|