C10H4F2O5-2 — CID 19379742
2-(2,4-difluorobenzoyl)propanedioate (PubChem CID 19379742) has the molecular formula C10H4F2O5-2 and a molecular weight of 242.13 g/mol. Its IUPAC name is 2-(2,4-difluorobenzoyl)propanedioate.
| Compound Name | 2-(2,4-difluorobenzoyl)propanedioate |
|---|---|
| PubChem CID | 19379742 |
| Molecular Formula | C10H4F2O5-2 |
| Molecular Weight | 242.13 g/mol |
| Exact Mass | 242.00 |
| IUPAC Name | 2-(2,4-difluorobenzoyl)propanedioate |
| SMILES | O=C([O-])C(C(=O)[O-])C(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C10H6F2O5/c11-4-1-2-5(6(12)3-4)8(13)7(9(14)15)10(16)17/h1-3,7H,(H,14,15)(H,16,17)/p-2 |
| InChIKey | HHJUCJTZWVUKOM-UHFFFAOYSA-L |
| XLogP | -1.74 |
| TPSA | 97.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.13 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|