About 4-fluorophthalate
4-fluorophthalate (PubChem CID 36688510) has the molecular formula C8H3FO4-2
and a molecular weight of 182.11 g/mol. Its IUPAC name is 4-fluorophthalate.
Molecular Properties
| Compound Name | 4-fluorophthalate |
| PubChem CID | 36688510 |
| Molecular Formula | C8H3FO4-2 |
| Molecular Weight | 182.11 g/mol |
| Exact Mass | 182.00 |
| IUPAC Name | 4-fluorophthalate |
| SMILES | O=C([O-])c1ccc(F)cc1C(=O)[O-] |
| InChI | InChI=1S/C8H5FO4/c9-4-1-2-5(7(10)11)6(3-4)8(12)13/h1-3H,(H,10,11)(H,12,13)/p-2 |
| InChIKey | OMCXTFVBNCFZMY-UHFFFAOYSA-L |
| XLogP | -1.45 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.11 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-fluorophthalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluorophthalate?
The IUPAC name of 4-fluorophthalate (CID 36688510) is 4-fluorophthalate.
What is the SMILES notation for 4-fluorophthalate?
The canonical SMILES for 4-fluorophthalate is O=C([O-])c1ccc(F)cc1C(=O)[O-].
What is the InChIKey of 4-fluorophthalate?
The InChIKey is OMCXTFVBNCFZMY-UHFFFAOYSA-L. The full InChI is InChI=1S/C8H5FO4/c9-4-1-2-5(7(10)11)6(3-4)8(12)13/h1-3H,(H,10,11)(H,12,13)/p-2.
What are the key properties of 4-fluorophthalate?
4-fluorophthalate has a molecular weight of 182.11 g/mol, XLogP of -1.45, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluorophthalate is sourced from PubChem (CID 36688510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).