About dipotassium;4-methylphthalate
dipotassium;4-methylphthalate (PubChem CID 140576906) has the molecular formula C9H6K2O4
and a molecular weight of 256.34 g/mol. Its IUPAC name is dipotassium;4-methylphthalate.
Molecular Properties
| Compound Name | dipotassium;4-methylphthalate |
| PubChem CID | 140576906 |
| Molecular Formula | C9H6K2O4 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 255.95 |
| IUPAC Name | dipotassium;4-methylphthalate |
| SMILES | Cc1ccc(C(=O)[O-])c(C(=O)[O-])c1.[K+].[K+] |
| InChI | InChI=1S/C9H8O4.2K/c1-5-2-3-6(8(10)11)7(4-5)9(12)13;;/h2-4H,1H3,(H,10,11)(H,12,13);;/q;2*+1/p-2 |
| InChIKey | KEESFKKZQIHTSA-UHFFFAOYSA-L |
| XLogP | -7.27 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | -7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze dipotassium;4-methylphthalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipotassium;4-methylphthalate?
The IUPAC name of dipotassium;4-methylphthalate (CID 140576906) is dipotassium;4-methylphthalate.
What is the SMILES notation for dipotassium;4-methylphthalate?
The canonical SMILES for dipotassium;4-methylphthalate is Cc1ccc(C(=O)[O-])c(C(=O)[O-])c1.[K+].[K+].
What is the InChIKey of dipotassium;4-methylphthalate?
The InChIKey is KEESFKKZQIHTSA-UHFFFAOYSA-L. The full InChI is InChI=1S/C9H8O4.2K/c1-5-2-3-6(8(10)11)7(4-5)9(12)13;;/h2-4H,1H3,(H,10,11)(H,12,13);;/q;2*+1/p-2.
What are the key properties of dipotassium;4-methylphthalate?
dipotassium;4-methylphthalate has a molecular weight of 256.34 g/mol, XLogP of -7.27, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dipotassium;4-methylphthalate is sourced from PubChem (CID 140576906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).