C15H9O6-3 — CID 19097982
benzene;benzene-1,2,4-tricarboxylate (PubChem CID 19097982) has the molecular formula C15H9O6-3 and a molecular weight of 285.23 g/mol. Its IUPAC name is benzene;benzene-1,2,4-tricarboxylate.
| Compound Name | benzene;benzene-1,2,4-tricarboxylate |
|---|---|
| PubChem CID | 19097982 |
| Molecular Formula | C15H9O6-3 |
| Molecular Weight | 285.23 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | benzene;benzene-1,2,4-tricarboxylate |
| SMILES | O=C([O-])c1ccc(C(=O)[O-])c(C(=O)[O-])c1.c1ccccc1 |
| InChI | InChI=1S/C9H6O6.C6H6/c10-7(11)4-1-2-5(8(12)13)6(3-4)9(14)15;1-2-4-6-5-3-1/h1-3H,(H,10,11)(H,12,13)(H,14,15);1-6H/p-3 |
| InChIKey | MGVKOFZYYCKJPP-UHFFFAOYSA-K |
| XLogP | -1.54 |
| TPSA | 120.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.23 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |