C9H4Na2O6 — CID 70295725
disodium;4-carboxybenzene-1,3-dicarboxylate (PubChem CID 70295725) has the molecular formula C9H4Na2O6 and a molecular weight of 254.10 g/mol. Its IUPAC name is disodium;4-carboxybenzene-1,3-dicarboxylate.
| Compound Name | disodium;4-carboxybenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 70295725 |
| Molecular Formula | C9H4Na2O6 |
| Molecular Weight | 254.10 g/mol |
| Exact Mass | 253.98 |
| IUPAC Name | disodium;4-carboxybenzene-1,3-dicarboxylate |
| SMILES | O=C([O-])c1ccc(C(=O)O)c(C(=O)[O-])c1.[Na+].[Na+] |
| InChI | InChI=1S/C9H6O6.2Na/c10-7(11)4-1-2-5(8(12)13)6(3-4)9(14)15;;/h1-3H,(H,10,11)(H,12,13)(H,14,15);;/q;2*+1/p-2 |
| InChIKey | BMANGTQYTVNZSD-UHFFFAOYSA-L |
| XLogP | -7.88 |
| TPSA | 117.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.10 |
| LogP ≤ 5 | -7.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |