C21H21N3O6 — CID 141107559
benzene-1,2,4-tricarboxylate;tris(1H-pyrrol-1-ium) (PubChem CID 141107559) has the molecular formula C21H21N3O6 and a molecular weight of 411.41 g/mol. Its IUPAC name is benzene-1,2,4-tricarboxylate;tris(1H-pyrrol-1-ium).
| Compound Name | benzene-1,2,4-tricarboxylate;tris(1H-pyrrol-1-ium) |
|---|---|
| PubChem CID | 141107559 |
| Molecular Formula | C21H21N3O6 |
| Molecular Weight | 411.41 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | benzene-1,2,4-tricarboxylate;tris(1H-pyrrol-1-ium) |
| SMILES | C1=C[NH2+]C=C1.C1=C[NH2+]C=C1.C1=C[NH2+]C=C1.O=C([O-])c1ccc(C(=O)[O-])c(C(=O)[O-])c1 |
| InChI | InChI=1S/C9H6O6.3C4H5N/c10-7(11)4-1-2-5(8(12)13)6(3-4)9(14)15;3*1-2-4-5-3-1/h1-3H,(H,10,11)(H,12,13)(H,14,15);3*1-5H |
| InChIKey | FNLKOLZCEWEQTL-UHFFFAOYSA-N |
| XLogP | -4.45 |
| TPSA | 170.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.41 |
| LogP ≤ 5 | -4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |