C18H18N6O6 — CID 22034840
benzene-1,2,4-tricarboxylate;tris(1H-imidazol-1-ium) (PubChem CID 22034840) has the molecular formula C18H18N6O6 and a molecular weight of 414.38 g/mol. Its IUPAC name is benzene-1,2,4-tricarboxylate;tris(1H-imidazol-1-ium).
| Compound Name | benzene-1,2,4-tricarboxylate;tris(1H-imidazol-1-ium) |
|---|---|
| PubChem CID | 22034840 |
| Molecular Formula | C18H18N6O6 |
| Molecular Weight | 414.38 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | benzene-1,2,4-tricarboxylate;tris(1H-imidazol-1-ium) |
| SMILES | C1=C[NH2+]C=N1.C1=C[NH2+]C=N1.C1=C[NH2+]C=N1.O=C([O-])c1ccc(C(=O)[O-])c(C(=O)[O-])c1 |
| InChI | InChI=1S/C9H6O6.3C3H4N2/c10-7(11)4-1-2-5(8(12)13)6(3-4)9(14)15;3*1-2-5-3-4-1/h1-3H,(H,10,11)(H,12,13)(H,14,15);3*1-3H,(H,4,5) |
| InChIKey | PUSLJRKCRDABOH-UHFFFAOYSA-N |
| XLogP | -6.03 |
| TPSA | 207.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.38 |
| LogP ≤ 5 | -6.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |