C30H33N9O6 — CID 173182752
benzene-1,2,4-tricarboxylate;tris(1-ethyl-2-methylimidazol-1-ium-1-carbonitrile) (PubChem CID 173182752) has the molecular formula C30H33N9O6 and a molecular weight of 615.65 g/mol. Its IUPAC name is benzene-1,2,4-tricarboxylate;tris(1-ethyl-2-methylimidazol-1-ium-1-carbonitrile).
| Compound Name | benzene-1,2,4-tricarboxylate;tris(1-ethyl-2-methylimidazol-1-ium-1-carbonitrile) |
|---|---|
| PubChem CID | 173182752 |
| Molecular Formula | C30H33N9O6 |
| Molecular Weight | 615.65 g/mol |
| Exact Mass | 615.26 |
| IUPAC Name | benzene-1,2,4-tricarboxylate;tris(1-ethyl-2-methylimidazol-1-ium-1-carbonitrile) |
| SMILES | CC[N+]1(C#N)C=CN=C1C.CC[N+]1(C#N)C=CN=C1C.CC[N+]1(C#N)C=CN=C1C.O=C([O-])c1ccc(C(=O)[O-])c(C(=O)[O-])c1 |
| InChI | InChI=1S/C9H6O6.3C7H10N3/c10-7(11)4-1-2-5(8(12)13)6(3-4)9(14)15;3*1-3-10(6-8)5-4-9-7(10)2/h1-3H,(H,10,11)(H,12,13)(H,14,15);3*4-5H,3H2,1-2H3/q;3*+1/p-3 |
| InChIKey | ZUOMEEBBWWCZDQ-UHFFFAOYSA-K |
| XLogP | 0.40 |
| TPSA | 228.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.65 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|