About 2-iodoterephthalate
2-iodoterephthalate (PubChem CID 23436472) has the molecular formula C8H3IO4-2
and a molecular weight of 290.01 g/mol. Its IUPAC name is 2-iodoterephthalate.
Molecular Properties
| Compound Name | 2-iodoterephthalate |
| PubChem CID | 23436472 |
| Molecular Formula | C8H3IO4-2 |
| Molecular Weight | 290.01 g/mol |
| Exact Mass | 289.91 |
| IUPAC Name | 2-iodoterephthalate |
| SMILES | O=C([O-])c1ccc(C(=O)[O-])c(I)c1 |
| InChI | InChI=1S/C8H5IO4/c9-6-3-4(7(10)11)1-2-5(6)8(12)13/h1-3H,(H,10,11)(H,12,13)/p-2 |
| InChIKey | LUZKKRPROWYBLR-UHFFFAOYSA-L |
| XLogP | -0.98 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.01 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-iodoterephthalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iodoterephthalate?
The IUPAC name of 2-iodoterephthalate (CID 23436472) is 2-iodoterephthalate.
What is the SMILES notation for 2-iodoterephthalate?
The canonical SMILES for 2-iodoterephthalate is O=C([O-])c1ccc(C(=O)[O-])c(I)c1.
What is the InChIKey of 2-iodoterephthalate?
The InChIKey is LUZKKRPROWYBLR-UHFFFAOYSA-L. The full InChI is InChI=1S/C8H5IO4/c9-6-3-4(7(10)11)1-2-5(6)8(12)13/h1-3H,(H,10,11)(H,12,13)/p-2.
What are the key properties of 2-iodoterephthalate?
2-iodoterephthalate has a molecular weight of 290.01 g/mol, XLogP of -0.98, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iodoterephthalate is sourced from PubChem (CID 23436472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).